cas: 1009376-67-3 — see every product listed under this CAS number, including other names
(3R,4R)-Methyl 4-methylpiperidine-3-carboxylate hydrochloride, 97% (CAS 1009376-67-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A466322-250mg |
| cas | 1009376-67-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 1922.31 Pln | |
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 659.60 Pln | |
| Chemat | 1g | 1523.60 Pln | |
| Chemat | 10g | 14531.60 Pln | |
| BLDpharm | 100mg | 436.54 Pln | |
| BLDpharm | 250mg | 880.83 Pln | |
| BLDpharm | 1g | 2396.96 Pln | |
| Fluorochem | 100mg | 612.30 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2830.27 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (3R,4R)-4-methylpiperidine-3-carboxylate;hydrochloride (CAS 1009376-67-3) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,4R)-4-methylpiperidine-3-carboxylate;hydrochloride. InChIKey: QATUSYOQNXADOL-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3R,4R)-4-methylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | QATUSYOQNXADOL-HHQFNNIRSA-N |
| SMILES | C[C@@H]1CCNC[C@@H]1C(=O)OC.Cl |
Computed by PubChem (NCBI)