CAS 1009376-77-5 appears in our catalog under these names: Cis-methyl 6-methylpiperidine-3-carboxylate hydrochloride, 95%, cis-Methyl 6-methylpiperidine-3-carboxylate hydrochloride, 98%, 98%, rel-Methyl-6-methylpiperidine-3-carboxylate hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 10g.
Methyl (3R,6S)-6-methylpiperidine-3-carboxylate;hydrochloride (CAS 1009376-77-5) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: methyl (3R,6S)-6-methylpiperidine-3-carboxylate;hydrochloride. InChIKey: COCIOCKRYRXGEP-UOERWJHTSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | methyl (3R,6S)-6-methylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | COCIOCKRYRXGEP-UOERWJHTSA-N |
| SMILES | C[C@H]1CC[C@H](CN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)