cas: 1007596-95-3 — see every product listed under this CAS number, including other names
(3R,4R)-Tert-Butyl 4-Amino-3-Hydroxypiperidine-1-Carboxylate, 97%, 97% (CAS 1007596-95-3) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 100mg, 250mg, 1g, 5g, 10g, 25g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1113U6-1kg |
| cas | 1007596-95-3 |
| size | 1kg |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 38570.00 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 669.20 Pln | |
| Chemat | 5g | 1442.00 Pln | |
| Chemat | 10g | 2128.40 Pln | |
| Chemat | 25g | 3851.60 Pln | |
| Chemat | 250g | 13346.00 Pln | |
| Chemat | 500g | 23755.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 1007596-95-3) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: KREUZCYJWPQPJX-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | KREUZCYJWPQPJX-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)