cas: 1007596-95-3 — see every product listed under this CAS number, including other names
tert-butyl (3R,4R)-4-amino-3-hydroxy-1-piperidinecarboxylate, 95% (CAS 1007596-95-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F053386-100MG |
| cas | 1007596-95-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 500mg | 706.02 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 3142.66 Pln | |
| Fluorochem | 10g | 5048.24 Pln | |
| Fluorochem | 25g | 9400.87 Pln | |
| Fluorochem | 50g | 18741.34 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate (CAS 1007596-95-3) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate. InChIKey: KREUZCYJWPQPJX-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4R)-4-amino-3-hydroxypiperidine-1-carboxylate |
| InChIKey | KREUZCYJWPQPJX-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)