cas: 148214-90-8 — see every product listed under this CAS number, including other names
(3R,4R)-rel-tert-Butyl 3-amino-4-hydroxypyrrolidine-1-carboxylate 95% (CAS 148214-90-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A290444-250mg |
| cas | 148214-90-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 392.62 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 1015.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A290444 |
Tert-butyl (3R,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate (CAS 148214-90-8) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MOZOQDNRVPHFOO-RNFRBKRXSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MOZOQDNRVPHFOO-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)