Products 265108-25-6

CAS 265108-25-6 is the registry number for Cis-(4-hydroxy-pyrrolidin-3-yl)-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate (CAS 265108-25-6) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate. InChIKey: QAZVTJCOYJOJGO-NKWVEPMBSA-N.

Identity
Molecular formulaC9H18N2O3
Molecular weight202.25 g/mol
IUPAC nametert-butyl N-[(3S,4R)-4-hydroxypyrrolidin-3-yl]carbamate
InChIKeyQAZVTJCOYJOJGO-NKWVEPMBSA-N
SMILESCC(C)(C)OC(=O)N[C@H]1CNC[C@H]1O

Computed by PubChem (NCBI)