cas: 1523530-23-5 — see every product listed under this CAS number, including other names
(3R,4R)-tert-Butyl 3-amino-4-hydroxypiperidine-1-carboxylate 98% (CAS 1523530-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A397017-100mg |
| cas | 1523530-23-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 548.38 Pln | |
| Ambeed | 250mg | 804.25 Pln | |
| Ambeed | 1g | 1905.62 Pln | |
| Ambeed | 5g | 5599.12 Pln | |
| Ambeed | 10g | 9403.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A397017 |
Tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate (CAS 1523530-23-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate. InChIKey: LUQURLQDYAJECW-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate |
| InChIKey | LUQURLQDYAJECW-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)N)O |
Computed by PubChem (NCBI)