cas: 1523530-23-5 — see every product listed under this CAS number, including other names
tert-butyl (3r,4r)-3-amino-4-hydroxypiperidine-1-carboxylate, 98%, 98% (CAS 1523530-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXYS-100mg |
| cas | 1523530-23-5 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 381.20 Pln | |
| Chemat | 250mg | 568.40 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1269.20 Pln | |
| Chemat | 5g | 4240.40 Pln | |
| Chemat | 10g | 7955.60 Pln | |
| Chemat | 25g | 18261.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate (CAS 1523530-23-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate. InChIKey: LUQURLQDYAJECW-HTQZYQBOSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl (3R,4R)-3-amino-4-hydroxypiperidine-1-carboxylate |
| InChIKey | LUQURLQDYAJECW-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]([C@@H](C1)N)O |
Computed by PubChem (NCBI)