cas: 945217-60-7 — see every product listed under this CAS number, including other names
(3R,4S)-rel-tert-Butyl 3,4-diaminopyrrolidine-1-carboxylate, 95% (CAS 945217-60-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A272787-100mg |
| cas | 945217-60-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 782.00 Pln | |
| Ambeed | 5g | 3351.88 Pln | |
| Ambeed | 25g | 15227.81 Pln | |
| BLDpharm | 100mg | 225.50 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 841.95 Pln | |
| BLDpharm | 5g | 3607.64 Pln | |
| BLDpharm | 25g | 16419.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate (CAS 945217-60-7) is a chemical compound with the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate. InChIKey: MOFRNGKMXMQTQR-KNVOCYPGSA-N.
| Molecular formula | C9H19N3O2 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-diaminopyrrolidine-1-carboxylate |
| InChIKey | MOFRNGKMXMQTQR-KNVOCYPGSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)N)N |
Computed by PubChem (NCBI)