CAS 1263281-41-9 is the registry number for (3R,4S)-Methyl 3-ethyl-4-hydrazinylpiperidine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (3R,4S)-3-ethyl-4-hydrazinylpiperidine-1-carboxylate (CAS 1263281-41-9) is a chemical compound with the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. IUPAC name: methyl (3R,4S)-3-ethyl-4-hydrazinylpiperidine-1-carboxylate. InChIKey: VPUAALDCXUEFCD-SFYZADRCSA-N.
| Molecular formula | C9H19N3O2 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | methyl (3R,4S)-3-ethyl-4-hydrazinylpiperidine-1-carboxylate |
| InChIKey | VPUAALDCXUEFCD-SFYZADRCSA-N |
| SMILES | CC[C@@H]1CN(CC[C@@H]1NN)C(=O)OC |
Computed by PubChem (NCBI)