(3R,4S,5S)-tert-Butyl 3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, 98%
cas: 120205-48-3 — see every product listed under this CAS number, including other names
(3R,4S,5S)-tert-Butyl 3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, 98% (CAS 120205-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F498506-100MG |
| cas | 120205-48-3 |
| size | 100mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 180.16 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1257.91 Pln | |
| Fluorochem | 10g | 1981.61 Pln | |
| Fluorochem | 25g | 4329.74 Pln | |
| Fluorochem | 100g | 11608.43 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 309.20 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1163.60 Pln | |
| Chemat | 25g | 2541.20 Pln | |
| Chemat | 50g | 4336.40 Pln | |
| Chemat | 100g | 5219.60 Pln | |
| Chemat | 250g | 11867.60 Pln | |
| Chemat | 500g | 22276.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride (CAS 120205-48-3) is a chemical compound with the molecular formula C14H30ClNO3 and a molecular weight of 295.84 g/mol. IUPAC name: tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride. InChIKey: JRXGCIIOQALIMZ-LWEGJDAASA-N.
| Molecular formula | C14H30ClNO3 |
|---|---|
| Molecular weight | 295.84 g/mol |
| IUPAC name | tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride |
| InChIKey | JRXGCIIOQALIMZ-LWEGJDAASA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)NC.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3r,4s,5s)-tert-butyl 3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, Monomethyl auristatin E intermediate-1, C14H30ClNO3, tert-butyl (3R,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride, JRXGCIIOQALIMZ-LWEGJDAASA-N, Dil HCI, orb402126, methylaminoheptanoatehydrochloride, (3r,4s,5s)-tert-butyl 3-methoxy-5-methyl-4-(methylamino)heptanoate HCl