CAS 154633-74-6 is the registry number for tert-Butyl (3S,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3S,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride (CAS 154633-74-6) is a chemical compound with the molecular formula C14H30ClNO3 and a molecular weight of 295.84 g/mol. IUPAC name: tert-butyl (3S,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride. InChIKey: JRXGCIIOQALIMZ-SQRKDXEHSA-N.
| Molecular formula | C14H30ClNO3 |
|---|---|
| Molecular weight | 295.84 g/mol |
| IUPAC name | tert-butyl (3S,4S,5S)-3-methoxy-5-methyl-4-(methylamino)heptanoate;hydrochloride |
| InChIKey | JRXGCIIOQALIMZ-SQRKDXEHSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@H](CC(=O)OC(C)(C)C)OC)NC.Cl |
Computed by PubChem (NCBI)