cas: 1462290-03-4 — see every product listed under this CAS number, including other names
(3R,5R)-3-cyclopropyl-5-methyl-2-oxo-pyrrolidine-3-carbonitrile, 97% (CAS 1462290-03-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12X0SM-100mg |
| cas | 1462290-03-4 |
| size | 100mg |
| availability | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1600.40 Pln | |
| Chemat | 250mg | 2517.20 Pln | |
| Chemat | 500mg | 4154.00 Pln | |
| Chemat | 1g | 6194.00 Pln | |
| Fluorochem | 100mg | 2981.26 Pln | |
| Fluorochem | 250mg | 4662.96 Pln | |
| Fluorochem | 500mg | 7568.19 Pln | |
| Fluorochem | 1g | 11296.04 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3R,5R)-3-cyclopropyl-5-methyl-2-oxopyrrolidine-3-carbonitrile (CAS 1462290-03-4) is a chemical compound with the molecular formula C9H12N2O and a molecular weight of 164.20 g/mol. IUPAC name: (3R,5R)-3-cyclopropyl-5-methyl-2-oxopyrrolidine-3-carbonitrile. InChIKey: OFLIZMHGJUWIHY-MUWHJKNJSA-N.
| Molecular formula | C9H12N2O |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (3R,5R)-3-cyclopropyl-5-methyl-2-oxopyrrolidine-3-carbonitrile |
| InChIKey | OFLIZMHGJUWIHY-MUWHJKNJSA-N |
| SMILES | C[C@@H]1C[C@](C(=O)N1)(C#N)C2CC2 |
Computed by PubChem (NCBI)