cas: 169749-99-9 — see every product listed under this CAS number, including other names
(3S)-(+)-1-Benzyl-3-(methylamino)pyrrolidine, >98.0%(GC) (CAS 169749-99-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B1583-1G |
| cas | 169749-99-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 242.77 Pln | |
| TCI | 5g | 567.30 Pln | |
| TCI | 25g | 1649.10 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
(3S)-1-benzyl-N-methylpyrrolidin-3-amine (CAS 169749-99-9) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3S)-1-benzyl-N-methylpyrrolidin-3-amine. InChIKey: UEAYAIWNQQWSBK-LBPRGKRZSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3S)-1-benzyl-N-methylpyrrolidin-3-amine |
| InChIKey | UEAYAIWNQQWSBK-LBPRGKRZSA-N |
| SMILES | CN[C@H]1CCN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)