cas: 169749-99-9 — see every product listed under this CAS number, including other names
(3S)-N-Methyl-1-(phenylmethyl)-3-pyrrolidinamine, 97%, 97% (CAS 169749-99-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114CNS-1g |
| cas | 169749-99-9 |
| size | 1g |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 664.40 Pln | |
| Chemat | 25g | 1408.40 Pln | |
| Chemat | 100g | 5368.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3S)-1-benzyl-N-methylpyrrolidin-3-amine (CAS 169749-99-9) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (3S)-1-benzyl-N-methylpyrrolidin-3-amine. InChIKey: UEAYAIWNQQWSBK-LBPRGKRZSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (3S)-1-benzyl-N-methylpyrrolidin-3-amine |
| InChIKey | UEAYAIWNQQWSBK-LBPRGKRZSA-N |
| SMILES | CN[C@H]1CCN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)