cas: 132883-43-3 — see every product listed under this CAS number, including other names
(3S)-(-)-3-(Trifluoroacetamido)pyrrolidine hydrochloride (CAS 132883-43-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F010758-1G |
| cas | 132883-43-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 700.81 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 25g | 5922.93 Pln |
| delivery time | 3-4 weeks |
|---|
2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride (CAS 132883-43-3) is a chemical compound with the molecular formula C6H10ClF3N2O and a molecular weight of 218.60 g/mol. IUPAC name: 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride. InChIKey: CMZSIQCZAFAEDH-WCCKRBBISA-N.
| Molecular formula | C6H10ClF3N2O |
|---|---|
| Molecular weight | 218.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride |
| InChIKey | CMZSIQCZAFAEDH-WCCKRBBISA-N |
| SMILES | C1CNC[C@H]1NC(=O)C(F)(F)F.Cl |
Computed by PubChem (NCBI)