(3S)-3-Amino-3-(3-chlorophenyl)propanamide, 95%
cas: 1307991-87-2 — see every product listed under this CAS number, including other names
(3S)-3-Amino-3-(3-chlorophenyl)propanamide, 95% (CAS 1307991-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1011380-100mg |
| cas | 1307991-87-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 704.12 Pln | |
| Ambeed | 250mg | 1149.12 Pln | |
| Ambeed | 1g | 2990.31 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 1024.40 Pln | |
| Chemat | 1g | 2762.00 Pln | |
| Fluorochem | 100mg | 1101.71 Pln | |
| Fluorochem | 250mg | 1893.10 Pln | |
| Fluorochem | 1g | 5115.92 Pln | |
| BLDpharm | 100mg | 697.56 Pln | |
| BLDpharm | 250mg | 1130.74 Pln | |
| BLDpharm | 1g | 2935.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(3S)-3-amino-3-(3-chlorophenyl)propanamide (CAS 1307991-87-2) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: (3S)-3-amino-3-(3-chlorophenyl)propanamide. InChIKey: RTPKAWXRWXENEJ-QMMMGPOBSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-chlorophenyl)propanamide |
| InChIKey | RTPKAWXRWXENEJ-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)[C@H](CC(=O)N)N |
Computed by PubChem (NCBI)