Products 98995-06-3
CAS 98995-06-3 appears in our catalog under these names: 4-Amino-2-chloro-N,N-dimethylbenzamide, 98%, 4-Amino-2-chloro-N,N-dimethylbenzamide. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 100g, 1g, 25g, on request.
4-amino-2-chloro-N,N-dimethylbenzamide (CAS 98995-06-3) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-amino-2-chloro-N,N-dimethylbenzamide. InChIKey: HYYZVBNRQCDKET-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-amino-2-chloro-N,N-dimethylbenzamide |
| InChIKey | HYYZVBNRQCDKET-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)