cas: 1821769-41-8 — see every product listed under this CAS number, including other names
(3S,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride 97% (CAS 1821769-41-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A790605-50mg |
| cas | 1821769-41-8 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1143.56 Pln | |
| Ambeed | 100mg | 1883.38 Pln | |
| Ambeed | 250mg | 3218.38 Pln | |
| Ambeed | 1g | 8380.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A790605 |
(3S,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 1821769-41-8) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3S,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-OJNIYTAOSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-OJNIYTAOSA-N |
| SMILES | C[C@@H]1CCN(C[C@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)