CAS 1062580-52-2 appears in our catalog under these names: Tofacitinib Impurity 19, (3R,4R)-N,4-Dimethyl-1-(phenylmethyl)-3-piperidinamine Dihydrochloride, >95% (HPLC), (3R,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride 95%, (3R,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 95%, 95%, (3R,4R)-1-Benzyl-N,4-dimethylpiperidin-3-amine dihydrochloride, 95%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1g, 2,5g, 5g, 25g, 100g, 10g.
(3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride (CAS 1062580-52-2) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: CVQNXCBXFOIHLH-DAIKJZOUSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3R,4R)-1-benzyl-N,4-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | CVQNXCBXFOIHLH-DAIKJZOUSA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1NC)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)