cas: 346610-79-5 — see every product listed under this CAS number, including other names
(3S,4R)-4-(Boc-amino)-1-Boc-pyrrolidine-3-carboxylic acid 98% (CAS 346610-79-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A250351-100mg |
| cas | 346610-79-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 704.12 Pln | |
| Ambeed | 250mg | 1126.88 Pln | |
| Ambeed | 1g | 2717.75 Pln | |
| Ambeed | 5g | 9331.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A250351 |
(3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 346610-79-5) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: MDJLYIHNKUJSBA-FPOVZHCZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (3S,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | MDJLYIHNKUJSBA-FPOVZHCZSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)