cas: 190792-75-7 — see every product listed under this CAS number, including other names
(3S,4R)-tert-Butyl 3-amino-4-hydroxypyrrolidine-1-carboxylate, 95%, 95% (CAS 190792-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113ETO-100mg |
| cas | 190792-75-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 500mg | 750.80 Pln | |
| Chemat | 1g | 1096.40 Pln | |
| Chemat | 5g | 4163.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate (CAS 190792-75-7) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MOZOQDNRVPHFOO-NKWVEPMBSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MOZOQDNRVPHFOO-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)