cas: 190792-75-7 — see every product listed under this CAS number, including other names
tert-butyl rac-(3S,4R)-3-amino-4-hydroxy-1-pyrrolidinecarboxylate, 97% (CAS 190792-75-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F385823-100MG |
| cas | 190792-75-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 763.29 Pln | |
| Fluorochem | 500mg | 1101.71 Pln | |
| Fluorochem | 1g | 1794.18 Pln | |
| Fluorochem | 5g | 6386.31 Pln | |
| Fluorochem | 10g | 12717.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate (CAS 190792-75-7) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate. InChIKey: MOZOQDNRVPHFOO-NKWVEPMBSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3-amino-4-hydroxypyrrolidine-1-carboxylate |
| InChIKey | MOZOQDNRVPHFOO-NKWVEPMBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@H](C1)O)N |
Computed by PubChem (NCBI)