CAS 190792-73-5 is the registry number for (3S,4S)-4-AMINOTETRAHYDROFURAN-3-OL HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(3S,4S)-4-aminooxolan-3-ol;hydrochloride (CAS 190792-73-5) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. IUPAC name: (3S,4S)-4-aminooxolan-3-ol;hydrochloride. InChIKey: XFDDJSOAVIFVIH-RFKZQXLXSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 139.58 g/mol |
| IUPAC name | (3S,4S)-4-aminooxolan-3-ol;hydrochloride |
| InChIKey | XFDDJSOAVIFVIH-RFKZQXLXSA-N |
| SMILES | C1[C@@H]([C@@H](CO1)O)N.Cl |
Computed by PubChem (NCBI)