CAS 1955473-62-7 appears in our catalog under these names: (3S,4R)-4-Aminotetrahydrofuran-3-ol hydrochloride, 95+%, (3S,4R)-4-Aminotetrahydrofuran-3-ol hydrochloride 95+%. Offered by: AmBeed. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
(3S,4R)-4-aminooxolan-3-ol;hydrochloride (CAS 1955473-62-7) is a chemical compound with the molecular formula C4H10ClNO2 and a molecular weight of 139.58 g/mol. IUPAC name: (3S,4R)-4-aminooxolan-3-ol;hydrochloride. InChIKey: XFDDJSOAVIFVIH-VKKIDBQXSA-N.
| Molecular formula | C4H10ClNO2 |
|---|---|
| Molecular weight | 139.58 g/mol |
| IUPAC name | (3S,4R)-4-aminooxolan-3-ol;hydrochloride |
| InChIKey | XFDDJSOAVIFVIH-VKKIDBQXSA-N |
| SMILES | C1[C@H]([C@@H](CO1)O)N.Cl |
Computed by PubChem (NCBI)