cas: 905854-03-7 — see every product listed under this CAS number, including other names
(3S,4S)-Tivantinib 99% (CAS 905854-03-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A470382-50mg |
| cas | 905854-03-7 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 470.50 Pln | |
| Ambeed | 100mg | 743.06 Pln | |
| Ambeed | 250mg | 1343.81 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A470382 |
(3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione (CAS 905854-03-7) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione. InChIKey: UCEQXRCJXIVODC-WOJBJXKFSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (3S,4S)-3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1H-indol-3-yl)pyrrolidine-2,5-dione |
| InChIKey | UCEQXRCJXIVODC-WOJBJXKFSA-N |
| SMILES | C1CC2=C3C(=CC=C2)C(=CN3C1)[C@@H]4[C@H](C(=O)NC4=O)C5=CNC6=CC=CC=C65 |
Computed by PubChem (NCBI)