Products 127192-72-7
CAS 127192-72-7 appears in our catalog under these names: Ethanol, 2-(4-[2,2':6',2''-terpyridin]-4'-ylphenoxy)-, 95%, 2-(4-((2,2':6',2''-Terpyridin)-4'-yl)phenoxy)ethanol, 97%, 2–(4–((2，2'：6'，2''–Terpyridin)–4'–yl)phenoxy)ethanol, ETHANOL, 2-(4-[2,2':6',2''-TERPYRIDIN]-4'-YLPHENOXY)-, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 10mg, 25mg, 50mg, 100mg.
2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol (CAS 127192-72-7) is a chemical compound with the molecular formula C23H19N3O2 and a molecular weight of 369.4 g/mol. IUPAC name: 2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol. InChIKey: ITTHDGHSDFMYOE-UHFFFAOYSA-N.
| Molecular formula | C23H19N3O2 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]ethanol |
| InChIKey | ITTHDGHSDFMYOE-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=CC(=N2)C3=CC=CC=N3)C4=CC=C(C=C4)OCCO |
Computed by PubChem (NCBI)