cas: 1434126-96-1 — see every product listed under this CAS number, including other names
(3S,4S)-tert-Butyl 3-amino-4-methylpiperidine-1-carboxylate 95% (CAS 1434126-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103201-100mg |
| cas | 1434126-96-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 776.44 Pln | |
| Ambeed | 250mg | 1354.94 Pln | |
| Ambeed | 1g | 3396.38 Pln | |
| Ambeed | 5g | 14988.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A103201 |
Tert-butyl (3S,4S)-3-amino-4-methylpiperidine-1-carboxylate (CAS 1434126-96-1) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl (3S,4S)-3-amino-4-methylpiperidine-1-carboxylate. InChIKey: OWWPBKGSGNQMPL-DTWKUNHWSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-amino-4-methylpiperidine-1-carboxylate |
| InChIKey | OWWPBKGSGNQMPL-DTWKUNHWSA-N |
| SMILES | C[C@H]1CCN(C[C@H]1N)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)