Products 2065246-75-3
CAS 2065246-75-3 is the registry number for (S)-1-Boc-2-(n-methyl-d3-aminomethyl)-pyrrolidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (2S)-2-[(trideuteriomethylamino)methyl]pyrrolidine-1-carboxylate (CAS 2065246-75-3) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 217.32 g/mol. IUPAC name: tert-butyl (2S)-2-[(trideuteriomethylamino)methyl]pyrrolidine-1-carboxylate. InChIKey: NHOPGDPSLMBDQD-FVSUGRHFSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 217.32 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(trideuteriomethylamino)methyl]pyrrolidine-1-carboxylate |
| InChIKey | NHOPGDPSLMBDQD-FVSUGRHFSA-N |
| SMILES | [2H]C([2H])([2H])NC[C@@H]1CCCN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)