cas: 849935-87-1 — see every product listed under this CAS number, including other names
(3S,4S)-tert-Butyl 3-hydroxy-4-(hydroxymethyl)pyrrolidine-1-carboxylate, 95%, 95% (CAS 849935-87-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G96T-10g |
| cas | 849935-87-1 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 9362.00 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1250.00 Pln | |
| Chemat | 5g | 5877.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4S)-3-hydroxy-4-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 849935-87-1) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl (3S,4S)-3-hydroxy-4-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BSTWKRUNXOFBPE-JGVFFNPUSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-hydroxy-4-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BSTWKRUNXOFBPE-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)O)CO |
Computed by PubChem (NCBI)