CAS 207924-92-3 appears in our catalog under these names: (S)-Boc-4-amino-pentanoic acid, 96%, (S)-4-((tert-Butoxycarbonyl)amino)pentanoic acid, 97%, (S)-Boc-γ-Nva-OH, 97%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg, 10g.
(4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 207924-92-3) is a chemical compound with the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. IUPAC name: (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: CVYVXURBKURNKE-ZETCQYMHSA-N.
| Molecular formula | C10H19NO4 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | (4S)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | CVYVXURBKURNKE-ZETCQYMHSA-N |
| SMILES | C[C@@H](CCC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)