cas: 874279-60-4 — see every product listed under this CAS number, including other names
(3S,5S)-Benzyl 3,5-dimethylpiperazine-1-carboxylate, 97% (CAS 874279-60-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A846428-5g |
| cas | 874279-60-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 14789.11 Pln | |
| AmBeed | 1g | 5232.43 Pln | |
| AmBeed | 10g | 24593.17 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl (3S,5S)-3,5-dimethylpiperazine-1-carboxylate (CAS 874279-60-4) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (3S,5S)-3,5-dimethylpiperazine-1-carboxylate. InChIKey: XYDSFNOXAYIVAR-RYUDHWBXSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (3S,5S)-3,5-dimethylpiperazine-1-carboxylate |
| InChIKey | XYDSFNOXAYIVAR-RYUDHWBXSA-N |
| SMILES | C[C@H]1CN(C[C@@H](N1)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)