CAS 623585-97-7 appears in our catalog under these names: cis-Benzyl 3,5-dimethylpiperazine-1-carboxylate, 97%, cis–Benzyl 3，5–dimethylpiperazine–1–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 100mg.
Benzyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate (CAS 623585-97-7) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate. InChIKey: XYDSFNOXAYIVAR-TXEJJXNPSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl (3R,5S)-3,5-dimethylpiperazine-1-carboxylate |
| InChIKey | XYDSFNOXAYIVAR-TXEJJXNPSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](N1)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)