cas: 429673-82-5 — see every product listed under this CAS number, including other names
(3S,4S)-tert-Butyl 3-((tert-butoxycarbonyl)(methyl)amino)-4-hydroxypyrrolidine-1-carboxylate, 95%, 95% (CAS 429673-82-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DX9G-100mg |
| cas | 429673-82-5 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 611.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3S,4S)-3-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate (CAS 429673-82-5) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: tert-butyl (3S,4S)-3-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate. InChIKey: LIUXUDRASSWGLX-QWRGUYRKSA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | tert-butyl (3S,4S)-3-hydroxy-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate |
| InChIKey | LIUXUDRASSWGLX-QWRGUYRKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)