CAS 958635-12-6 appears in our catalog under these names: (S)-Di-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 95%, (S)-Di-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 97%, (S)-Di-tert-butyl 2-(hydroxymethyl)piperazine-1,4-dicarboxylate, 97%, 97%, (S)-DI-TERT-BUTYL 2-(HYDROXYMETHYL)PIPERAZINE-1,4-DICARBOXYLATE. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g, 500mg.
Ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate (CAS 958635-12-6) is a chemical compound with the molecular formula C15H28N2O5 and a molecular weight of 316.39 g/mol. IUPAC name: ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate. InChIKey: TXCFQKQBPSGAKK-NSHDSACASA-N.
| Molecular formula | C15H28N2O5 |
|---|---|
| Molecular weight | 316.39 g/mol |
| IUPAC name | ditert-butyl (2S)-2-(hydroxymethyl)piperazine-1,4-dicarboxylate |
| InChIKey | TXCFQKQBPSGAKK-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)