cas: 1255942-07-4 — see every product listed under this CAS number, including other names
(3aS,4S,6aR)-N-[19-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-15,19-dioxo-3,6,9,12-tetraoxa-16-azanonadec-1-yl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanamide, 96%, 96% (CAS 1255942-07-4) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110ZX7-1mg |
| cas | 1255942-07-4 |
| size | 1mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 285.20 Pln | |
| Chemat | 5mg | 736.40 Pln | |
| Chemat | 10mg | 1182.80 Pln | |
| Chemat | 25mg | 1859.60 Pln | |
| Chemat | 50mg | 3654.80 Pln | |
| Chemat | 100mg | 6165.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (CAS 1255942-07-4) is a chemical compound with the molecular formula C39H51N5O8S and a molecular weight of 749.9 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide. InChIKey: LNHSQAOQVNHUGL-QRBHCBQLSA-N.
| Molecular formula | C39H51N5O8S |
|---|---|
| Molecular weight | 749.9 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | LNHSQAOQVNHUGL-QRBHCBQLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCC(=O)NCCC(=O)N3CC4=CC=CC=C4C#CC5=CC=CC=C53)NC(=O)N2 |
Computed by PubChem (NCBI)