cas: 1255942-07-4 — see every product listed under this CAS number, including other names
DBCO-PEG4-Biotin, 98% (CAS 1255942-07-4) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554689-5MG |
| cas | 1255942-07-4 |
| size | 5mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5mg | 909.07 Pln | |
| Fluorochem | 10mg | 1497.41 Pln | |
| Fluorochem | 25mg | 2939.61 Pln | |
| Fluorochem | 50mg | 4949.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (CAS 1255942-07-4) is a chemical compound with the molecular formula C39H51N5O8S and a molecular weight of 749.9 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide. InChIKey: LNHSQAOQVNHUGL-QRBHCBQLSA-N.
| Molecular formula | C39H51N5O8S |
|---|---|
| Molecular weight | 749.9 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[3-[[3-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-3-oxopropyl]amino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | LNHSQAOQVNHUGL-QRBHCBQLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCC(=O)NCCC(=O)N3CC4=CC=CC=C4C#CC5=CC=CC=C53)NC(=O)N2 |
Computed by PubChem (NCBI)