cas: 1374451-80-5 — see every product listed under this CAS number, including other names
(4-(((tert-Butoxycarbonyl)amino)methyl)-3-fluorophenyl)boronic acid 98% (CAS 1374451-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1163128-100mg |
| cas | 1374451-80-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 1160.25 Pln | |
| Ambeed | 25g | 4364.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1163128 |
[3-fluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 1374451-80-5) is a chemical compound with the molecular formula C12H17BFNO4 and a molecular weight of 269.08 g/mol. IUPAC name: [3-fluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: SAYNYRGHIRMQPN-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO4 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | [3-fluoro-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | SAYNYRGHIRMQPN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CNC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)