CAS 2377609-67-9 is the registry number for 4-(N-BOC-N-Methylamino)-2-fluorophenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
[2-fluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid (CAS 2377609-67-9) is a chemical compound with the molecular formula C12H17BFNO4 and a molecular weight of 269.08 g/mol. IUPAC name: [2-fluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid. InChIKey: SLNXRRNKDOKEGZ-UHFFFAOYSA-N.
| Molecular formula | C12H17BFNO4 |
|---|---|
| Molecular weight | 269.08 g/mol |
| IUPAC name | [2-fluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]boronic acid |
| InChIKey | SLNXRRNKDOKEGZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N(C)C(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)