cas: 860626-05-7 — see every product listed under this CAS number, including other names
(4-((2-((tert-Butoxycarbonyl)amino)ethyl)carbamoyl)phenyl)boronic acid 97% (CAS 860626-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A780400-100mg |
| cas | 860626-05-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 515.00 Pln | |
| Ambeed | 1g | 1505.12 Pln | |
| Ambeed | 5g | 3474.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A780400 |
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid (CAS 860626-05-7) is a chemical compound with the molecular formula C14H21BN2O5 and a molecular weight of 308.14 g/mol. IUPAC name: [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid. InChIKey: UGXDZSTUJOMASN-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O5 |
|---|---|
| Molecular weight | 308.14 g/mol |
| IUPAC name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid |
| InChIKey | UGXDZSTUJOMASN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)