cas: 860626-05-7 — see every product listed under this CAS number, including other names
4-(2-Boc-amino)ethylcarbamoyl)phenylboronic acid, 97%, 97% (CAS 860626-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119FJJ-100mg |
| cas | 860626-05-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2190.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid (CAS 860626-05-7) is a chemical compound with the molecular formula C14H21BN2O5 and a molecular weight of 308.14 g/mol. IUPAC name: [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid. InChIKey: UGXDZSTUJOMASN-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O5 |
|---|---|
| Molecular weight | 308.14 g/mol |
| IUPAC name | [4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylcarbamoyl]phenyl]boronic acid |
| InChIKey | UGXDZSTUJOMASN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCCNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)