cas: 874288-01-4 — see every product listed under this CAS number, including other names
(4-((2-Bromophenyl)carbamoyl)phenyl)boronic acid 95% (CAS 874288-01-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A333724-1g |
| cas | 874288-01-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 225.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A333724 |
[4-[(2-bromophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-01-4) is a chemical compound with the molecular formula C13H11BBrNO3 and a molecular weight of 319.95 g/mol. IUPAC name: [4-[(2-bromophenyl)carbamoyl]phenyl]boronic acid. InChIKey: COKKVGHDIYNFCQ-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrNO3 |
|---|---|
| Molecular weight | 319.95 g/mol |
| IUPAC name | [4-[(2-bromophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | COKKVGHDIYNFCQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2Br)(O)O |
Computed by PubChem (NCBI)