CAS 874288-28-5 appears in our catalog under these names: 3-(4-Bromophenylcarbamoyl)phenylboronic acid, 98%, (3-((4-Bromophenyl)carbamoyl)phenyl)boronic acid, 98%, (3-((4-Bromophenyl)carbamoyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g.
[3-[(4-bromophenyl)carbamoyl]phenyl]boronic acid (CAS 874288-28-5) is a chemical compound with the molecular formula C13H11BBrNO3 and a molecular weight of 319.95 g/mol. IUPAC name: [3-[(4-bromophenyl)carbamoyl]phenyl]boronic acid. InChIKey: JTIUHKZUVGVPGO-UHFFFAOYSA-N.
| Molecular formula | C13H11BBrNO3 |
|---|---|
| Molecular weight | 319.95 g/mol |
| IUPAC name | [3-[(4-bromophenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | JTIUHKZUVGVPGO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=C(C=C2)Br)(O)O |
Computed by PubChem (NCBI)