cas: 874460-12-5 — see every product listed under this CAS number, including other names
(4-((4-Fluorobenzyl)carbamoyl)phenyl)boronic acid, 95%, 95% (CAS 874460-12-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FPLI-250mg |
| cas | 874460-12-5 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[(4-fluorophenyl)methylcarbamoyl]phenyl]boronic acid (CAS 874460-12-5) is a chemical compound with the molecular formula C14H13BFNO3 and a molecular weight of 273.07 g/mol. IUPAC name: [4-[(4-fluorophenyl)methylcarbamoyl]phenyl]boronic acid. InChIKey: GHODZRCPFKAHCA-UHFFFAOYSA-N.
| Molecular formula | C14H13BFNO3 |
|---|---|
| Molecular weight | 273.07 g/mol |
| IUPAC name | [4-[(4-fluorophenyl)methylcarbamoyl]phenyl]boronic acid |
| InChIKey | GHODZRCPFKAHCA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC2=CC=C(C=C2)F)(O)O |
Computed by PubChem (NCBI)