CAS 874289-19-7 appears in our catalog under these names: N-Benzyl 4-borono-2-fluorobenzamide, 97%, (4-(Benzylcarbamoyl)-3-fluorophenyl)boronic acid 97%, (4-(Benzylcarbamoyl)-3-fluorophenyl)boronic acid, 97%, 97%, (4-(Benzylcarbamoyl)-3-fluorophenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
[4-(benzylcarbamoyl)-3-fluorophenyl]boronic acid (CAS 874289-19-7) is a chemical compound with the molecular formula C14H13BFNO3 and a molecular weight of 273.07 g/mol. IUPAC name: [4-(benzylcarbamoyl)-3-fluorophenyl]boronic acid. InChIKey: XTSLGOGQMXSTRK-UHFFFAOYSA-N.
| Molecular formula | C14H13BFNO3 |
|---|---|
| Molecular weight | 273.07 g/mol |
| IUPAC name | [4-(benzylcarbamoyl)-3-fluorophenyl]boronic acid |
| InChIKey | XTSLGOGQMXSTRK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)