cas: 1256358-66-3 — see every product listed under this CAS number, including other names
(4-((Furan-2-ylmethoxy)methyl)phenyl)boronic acid 97% (CAS 1256358-66-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A270635-250mg |
| cas | 1256358-66-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 1927.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A270635 |
[4-(furan-2-ylmethoxymethyl)phenyl]boronic acid (CAS 1256358-66-3) is a chemical compound with the molecular formula C12H13BO4 and a molecular weight of 232.04 g/mol. IUPAC name: [4-(furan-2-ylmethoxymethyl)phenyl]boronic acid. InChIKey: CAFRQKZXINEFIJ-UHFFFAOYSA-N.
| Molecular formula | C12H13BO4 |
|---|---|
| Molecular weight | 232.04 g/mol |
| IUPAC name | [4-(furan-2-ylmethoxymethyl)phenyl]boronic acid |
| InChIKey | CAFRQKZXINEFIJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COCC2=CC=CO2)(O)O |
Computed by PubChem (NCBI)