Products 2246782-98-7

CAS 2246782-98-7 is the registry number for [6-(methoxymethoxy)naphthalen-2-yl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.

Structural formula: {0} (CAS {1})

[6-(methoxymethoxy)naphthalen-2-yl]boronic acid (CAS 2246782-98-7) is a chemical compound with the molecular formula C12H13BO4 and a molecular weight of 232.04 g/mol. IUPAC name: [6-(methoxymethoxy)naphthalen-2-yl]boronic acid. InChIKey: BGIHUINMAWPVRY-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13BO4
Molecular weight232.04 g/mol
IUPAC name[6-(methoxymethoxy)naphthalen-2-yl]boronic acid
InChIKeyBGIHUINMAWPVRY-UHFFFAOYSA-N
SMILESB(C1=CC2=C(C=C1)C=C(C=C2)OCOC)(O)O

Computed by PubChem (NCBI)