CAS 2246782-98-7 is the registry number for [6-(methoxymethoxy)naphthalen-2-yl]boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
[6-(methoxymethoxy)naphthalen-2-yl]boronic acid (CAS 2246782-98-7) is a chemical compound with the molecular formula C12H13BO4 and a molecular weight of 232.04 g/mol. IUPAC name: [6-(methoxymethoxy)naphthalen-2-yl]boronic acid. InChIKey: BGIHUINMAWPVRY-UHFFFAOYSA-N.
| Molecular formula | C12H13BO4 |
|---|---|
| Molecular weight | 232.04 g/mol |
| IUPAC name | [6-(methoxymethoxy)naphthalen-2-yl]boronic acid |
| InChIKey | BGIHUINMAWPVRY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C=C(C=C2)OCOC)(O)O |
Computed by PubChem (NCBI)