cas: 850568-18-2 — see every product listed under this CAS number, including other names
(4-((Furan-2-ylmethyl)carbamoyl)phenyl)boronic acid, 98%, 98% (CAS 850568-18-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115PC3-250mg |
| cas | 850568-18-2 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 208.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid (CAS 850568-18-2) is a chemical compound with the molecular formula C12H12BNO4 and a molecular weight of 245.04 g/mol. IUPAC name: [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid. InChIKey: KXSMENBYQORPAK-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO4 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid |
| InChIKey | KXSMENBYQORPAK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NCC2=CC=CO2)(O)O |
Computed by PubChem (NCBI)