CAS 2096338-80-4 appears in our catalog under these names: 6-(3-Methoxyphenoxy)pyridine-3-boronic acid, 98%, (6-(3-Methoxyphenoxy)pyridin-3-yl)boronic acid 97%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
[6-(3-methoxyphenoxy)-3-pyridinyl]boronic acid (CAS 2096338-80-4) is a chemical compound with the molecular formula C12H12BNO4 and a molecular weight of 245.04 g/mol. IUPAC name: [6-(3-methoxyphenoxy)-3-pyridinyl]boronic acid. InChIKey: FCZJZYPOHOACOG-UHFFFAOYSA-N.
| Molecular formula | C12H12BNO4 |
|---|---|
| Molecular weight | 245.04 g/mol |
| IUPAC name | [6-(3-methoxyphenoxy)-3-pyridinyl]boronic acid |
| InChIKey | FCZJZYPOHOACOG-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)OC2=CC=CC(=C2)OC)(O)O |
Computed by PubChem (NCBI)