cas: 1415960-56-3 — see every product listed under this CAS number, including other names
(4-((TERT-BUTOXYCARBONYL)AMINO)-2-FLUOROPHENYL)BORONIC ACID, 98% (CAS 1415960-56-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F473937-250MG |
| cas | 1415960-56-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 768.50 Pln | |
| Fluorochem | 5g | 2627.22 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 1415960-56-3) is a chemical compound with the molecular formula C11H15BFNO4 and a molecular weight of 255.05 g/mol. IUPAC name: [2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: DAISURXDKVZMGH-UHFFFAOYSA-N.
| Molecular formula | C11H15BFNO4 |
|---|---|
| Molecular weight | 255.05 g/mol |
| IUPAC name | [2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | DAISURXDKVZMGH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)NC(=O)OC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)